| Product Number |
Product Name |
CAS Number |
MW |
| AX-H198 |
5,6-Dithia-2,9,11-triazatridecanamide,13-chloro-N-(2-chloroethyl)-N,11-dinitroso-10-oxo- |
77469-44-4 |
421.36 |
| AX-H199 |
5,6-Dithia-2,9,11-triazatridecanamide,13-chloro-N-(2-chloroethyl)-10-oxo- |
77456-13-4 |
|
| AX-H19A |
5,6-Dithia-2,9,11-triazatridecanamide,13- chloro-N-(2-chloroethyl)-N,11(or 2,9)-dinitroso-10-oxo- |
82599-22-2 |
|
| AX-H19B |
5,6-Dithia-2,9,11-triazadodecanimidamide,10-imino-N-methyl-, hydriodide (1:2) |
16181-93-4 |
520.2394 |
| AX-H19C |
5,6-Dimethoxysterigmatocystin,3a,12c-dihydro-8-hydroxy-6,10,11-trimethoxy-, (3aR,12cS)- (9CI) |
65176-75-2 |
382.34 |
| AX-H19D |
5,6-Dihydroxynaphtho(2,3-f)quinoline-7,12-dione, compound with monosodium sulphite (1:2) |
10181-46-1 |
0 |
| AX-H19E |
5,6-Dihydroprostaglandin I2 |
62770-50-7 |
|
| AX-H19F |
5,6-Dihydro-PGE3 |
7046-45-9 |
0 |
| AX-H19G |
5,6-Dihydrobenz(a)anthracene-5,6-diol trans-(+-)- |
67315-17-7 |
262.3026 |
| AX-H19H |
5,6-Dihydro-2,4-diphenylnaphtho(1,2-b)thiopyrylium salt with trifluoroacetic acid (1:1) |
65193-66-0 |
464.4988 |
